How to Optimize Auxiliary Space Of a DP Solution.
Last Updated :
12 Mar, 2024
Space Optimization in Dynamic Programming Problems:
This is a way to optimize the Auxlillary space of a solution which also produces the same correct result as before optimization.
How to Optimize Space in the DP Solution:
The idea is to store only the values that are necessary to generate the result for the current state of the DP solution.
Avoid storing the states that do not contribute to the current state.
Follow the below steps to optimize the space of any DP solution:
- Identify the transition of states and observe clearly what states are needed to calculate the current state.
- Store all the previous states that are needed to calculate the current state separately in variables or arrays.
- After calculating the current state, update the previous states for the next state that is to be calculated.
- The result is stored in the first previous state if there are multiple previous states.
Let's see these steps with examples,
Space optimization from O(N)Linear to O(1)Constant:
Calculate the nth Fibonacci number:
State: f[i] --> Denotes the ith Fibonacci number.
Transition: f[i] = f[i-1] + f[i-2]
Code:
C++
// C++ program for Fibonacci Series
// using Dynamic Programming
#include <bits/stdc++.h>
using namespace std;
class GFG {
public:
int fib(int n)
{
// Declare an array to store
// Fibonacci numbers.
// 1 extra to handle
// case, n = 0
int f[n + 2];
int i;
// 0th and 1st number of the
// series are 0 and 1
f[0] = 0;
f[1] = 1;
for (i = 2; i <= n; i++) {
// Add the previous 2 numbers
// in the series and store it
f[i] = f[i - 1] + f[i - 2];
}
return f[n];
}
};
// Driver code
int main()
{
GFG g;
int n = 9;
cout << g.fib(n);
return 0;
}
Java
public class Fibonacci {
public int fib(int n) {
// Declare an array to store Fibonacci numbers.
// 1 extra to handle case, n = 0
int[] f = new int[n + 2];
int i;
// 0th and 1st number of the series are 0 and 1
f[0] = 0;
f[1] = 1;
for (i = 2; i <= n; i++) {
// Add the previous 2 numbers in the series and store it
f[i] = f[i - 1] + f[i - 2];
}
return f[n];
}
// Driver code
public static void main(String[] args) {
Fibonacci fibonacci = new Fibonacci();
int n = 9;
System.out.println(fibonacci.fib(n));
}
}
C#
using System;
public class Fibonacci
{
public int Fib(int n)
{
// Declare an array to store Fibonacci numbers.
// 1 extra to handle case, n = 0
int[] f = new int[n + 2];
int i;
// 0th and 1st number of the series are 0 and 1
f[0] = 0;
f[1] = 1;
for (i = 2; i <= n; i++)
{
// Add the previous 2 numbers in the series and store it
f[i] = f[i - 1] + f[i - 2];
}
return f[n];
}
// Driver code
public static void Main(string[] args)
{
Fibonacci fibonacci = new Fibonacci();
int n = 9;
Console.WriteLine(fibonacci.Fib(n));
}
}
Javascript
class Fibonacci {
fib(n) {
// Declare an array to store Fibonacci numbers.
// 1 extra to handle case, n = 0
const f = new Array(n + 2);
let i;
// 0th and 1st number of the series are 0 and 1
f[0] = 0;
f[1] = 1;
for (i = 2; i <= n; i++) {
// Add the previous 2 numbers in the series and store it
f[i] = f[i - 1] + f[i - 2];
}
return f[n];
}
}
// Driver code
const fibonacci = new Fibonacci();
const n = 9;
console.log(fibonacci.fib(n));
Python3
class GFG:
def fib(self, n):
# Declare a list to store Fibonacci numbers.
# 1 extra to handle the case, n = 0
f = [0] * (n + 2)
# 0th and 1st number of the series are 0 and 1
f[0] = 0
f[1] = 1
for i in range(2, n + 1):
# Add the previous 2 numbers
# in the series and store it
f[i] = f[i - 1] + f[i - 2]
return f[n]
# Driver code
if __name__ == "__main__":
g = GFG()
n = 9
print(g.fib(n))
Time Complexity: O(N)
Auxiliary space: O(N)
Steps To Optimise the Space in action for above problem:
- If we observe clearly, To generate the f[i] we need only two previous states that is f[i-1] and f[i-2].
- Store previous two states in prev1 and prev2 and current in curr.
- After calculating the curr, update the prev2 as prev1 and prev1 as curr.
- At the end, result is stored in the prev1.
Space Optimised Code:
C++
// Fibonacci Series using Space Optimized Method
#include <bits/stdc++.h>
using namespace std;
int fib(int n)
{
int prev2 = 0;
if (n == 0)
return prev2;
int prev1 = 1;
int curr;
for (int i = 2; i <= n; i++) {
curr = prev1 + prev2;
prev2 = prev1;
prev1 = curr;
}
return prev1;
}
// Driver code
int main()
{
int n = 9;
cout << fib(n);
return 0;
}
Java
public class FibonacciSeries {
public static int fib(int n) {
int prev2 = 0;
if (n == 0)
return prev2;
int prev1 = 1;
int curr;
for (int i = 2; i <= n; i++) {
curr = prev1 + prev2;
prev2 = prev1;
prev1 = curr;
}
return prev1;
}
public static void main(String[] args) {
int n = 9;
System.out.println(fib(n));
}
}
C#
using System;
class Program {
// Function to calculate the Fibonacci number at index n
static int Fibonacci(int n)
{
int prev2 = 0;
if (n == 0)
return prev2;
int prev1 = 1;
int curr;
for (int i = 2; i <= n; i++) {
curr = prev1 + prev2;
prev2 = prev1;
prev1 = curr;
}
return prev1;
}
// Main method
static void Main(string[] args)
{
int n = 9; // Index of the Fibonacci number to find
Console.WriteLine(Fibonacci(
n)); // Print the Fibonacci number at index n
}
}
Javascript
// Function to calculate the Fibonacci series using space-optimized method
function fib(n) {
let prev2 = 0; // Initialize the first Fibonacci number (0)
if (n === 0) return prev2; // If n is 0, return the first Fibonacci number
let prev1 = 1; // Initialize the second Fibonacci number (1)
let curr; // Initialize the current Fibonacci number
for (let i = 2; i <= n; i++) { // Loop through from the 3rd Fibonacci number to the nth Fibonacci number
curr = prev1 + prev2; // Calculate the current Fibonacci number by adding the previous two Fibonacci numbers
prev2 = prev1; // Update the previous two Fibonacci numbers for the next iteration
prev1 = curr;
}
return prev1;
}
// Driver code
let n = 9;
console.log(fib(n));
Python3
def fib(n):
prev2, prev1 = 0, 1
if n == 0:
return prev2
for i in range(2, n + 1):
curr = prev1 + prev2
prev2, prev1 = prev1, curr
return prev1
# Driver code
if __name__ == "__main__":
n = 9
print(fib(n))
Time Complexity: O(N)
Auxillary space: O(1)
Space optimization from O(N*Sum)Quadratic to O(Sum)Linear In Subset Sum Problem:
Subset Sum problem Using Dynamic programming:
In approach of dynamic programming we have derived the relation between states as given below:
if (A[i-1] > j)
dp[i][j] = dp[i-1][j]
else
dp[i][j] = dp[i-1][j] OR dp[i-1][j-A[i-1]]
Steps To Optimize Space in action for above problem:
- If we observe that for calculating current dp[i][j] state we only need previous row dp[i-1][j] or dp[i-1][j-A[i-1]].There is no need to store all the previous states just one previous state is used to compute result.
- Define two arrays prev and curr of size Sum+1 to store the just previous row result and current row result respectively.
- Once curr array is calculated then curr becomes our prev for the next row.
- When all rows are processed the answer is stored in prev array.
Space optimised Implementation:
C++
// A Dynamic Programming solution
// for subset sum problem with space optimization
#include <bits/stdc++.h>
using namespace std;
// Returns true if there is a subset of set[]
// with sum equal to given sum
bool isSubsetSum(int set[], int n, int sum)
{
vector<bool> prev(sum + 1);
// If sum is 0, then answer is true
for (int i = 0; i <= n; i++)
prev[0] = true;
// If sum is not 0 and set is empty,
// then answer is false
for (int i = 1; i <= sum; i++)
prev[i] = false;
// curr array to store the current row result generated
// with help of prev array
vector<bool> curr(sum + 1);
for (int i = 1; i <= n; i++) {
for (int j = 1; j <= sum; j++) {
if (j < set[i - 1])
curr[j] = prev[j];
if (j >= set[i - 1])
curr[j] = prev[j] || prev[j - set[i - 1]];
}
// now curr becomes prev for i+1 th element
prev = curr;
}
return prev[sum];
}
// Driver code
int main()
{
int set[] = { 3, 34, 4, 12, 5, 2 };
int sum = 9;
int n = sizeof(set) / sizeof(set[0]);
if (isSubsetSum(set, n, sum) == true)
cout << "Found a subset with given sum";
else
cout << "No subset with given sum";
return 0;
}
Java
import java.util.*;
class SubsetSum {
// Returns true if there is a subset of set[]
// with sum equal to given sum
static boolean isSubsetSum(int[] set, int n, int sum) {
boolean[] prev = new boolean[sum + 1];
// If sum is 0, then answer is true
for (int i = 0; i <= n; i++)
prev[0] = true;
// If sum is not 0 and set is empty,
// then answer is false
for (int i = 1; i <= sum; i++)
prev[i] = false;
// curr array to store the current row result generated
// with help of prev array
boolean[] curr = new boolean[sum + 1];
for (int i = 1; i <= n; i++) {
for (int j = 1; j <= sum; j++) {
if (j < set[i - 1])
curr[j] = prev[j];
if (j >= set[i - 1])
curr[j] = prev[j] || prev[j - set[i - 1]];
}
// now curr becomes prev for i+1 th element
prev = curr.clone();
}
return prev[sum];
}
// Driver code
public static void main(String args[]) {
int[] set = { 3, 34, 4, 12, 5, 2 };
int sum = 9;
int n = set.length;
if (isSubsetSum(set, n, sum))
System.out.println("Found a subset with given sum");
else
System.out.println("No subset with given sum");
}
}
//This code is contributed by Utkarsh
C#
using System;
public class SubsetSum {
// Returns true if there is a subset of set[]
// with sum equal to given sum
public static bool IsSubsetSum(int[] set, int n,
int sum)
{
// Create a boolean array to store the results
// of subproblems. The value dp[i, j] will be
// true if there is a subset of set[0..j-1]
// with sum equal to i.
bool[, ] dp = new bool[sum + 1, n + 1];
// If sum is 0, then answer is true
for (int i = 0; i <= n; i++)
dp[0, i] = true;
// If sum is not 0 and set is empty,
// then answer is false
for (int i = 1; i <= sum; i++)
dp[i, 0] = false;
// Fill dp[][] in bottom up manner
for (int i = 1; i <= sum; i++) {
for (int j = 1; j <= n; j++) {
dp[i, j] = dp[i, j - 1];
if (i >= set[j - 1])
dp[i, j] = dp[i, j]
|| dp[i - set[j - 1], j - 1];
}
}
return dp[sum, n];
}
// Driver code
public static void Main(string[] args)
{
int[] set = { 3, 34, 4, 12, 5, 2 };
int sum = 9;
int n = set.Length;
if (IsSubsetSum(set, n, sum))
Console.WriteLine(
"Found a subset with given sum");
else
Console.WriteLine("No subset with given sum");
}
}
Javascript
// Returns true if there is a subset of set[]
// with sum equal to given sum
function isSubsetSum(set, n, sum) {
let prev = new Array(sum + 1);
// If sum is 0, then answer is true
for (let i = 0; i <= n; i++)
prev[0] = true;
// If sum is not 0 and set is empty,
// then answer is false
for (let i = 1; i <= sum; i++)
prev[i] = false;
// curr array to store the current row result generated
// with help of prev array
let curr = new Array(sum + 1);
for (let i = 1; i <= n; i++) {
for (let j = 1; j <= sum; j++) {
if (j < set[i - 1])
curr[j] = prev[j];
if (j >= set[i - 1])
curr[j] = prev[j] || prev[j - set[i - 1]];
}
// now curr becomes prev for i+1 th element
prev = curr.slice(); // Copying array to avoid reference sharing
}
return prev[sum];
}
// Driver code
function main() {
let set = [3, 34, 4, 12, 5, 2];
let sum = 9;
let n = set.length;
if (isSubsetSum(set, n, sum))
console.log("Found a subset with given sum");
else
console.log("No subset with given sum");
}
// Call the main function
main();
Python3
def isSubsetSum(set, n, sum):
prev = [False] * (sum + 1)
# If sum is 0, then answer is true
for i in range(n + 1):
prev[0] = True
# If sum is not 0 and set is empty,
# then answer is false
for i in range(1, sum + 1):
prev[i] = False
# curr array to store the current row result generated
# with help of prev array
curr = [False] * (sum + 1)
for i in range(1, n + 1):
for j in range(1, sum + 1):
if j < set[i - 1]:
curr[j] = prev[j]
if j >= set[i - 1]:
curr[j] = prev[j] or prev[j - set[i - 1]]
# now curr becomes prev for i+1 th element
prev = curr[:]
return prev[sum]
# Driver code
if __name__ == "__main__":
set = [3, 34, 4, 12, 5, 2]
sum = 9
n = len(set)
if isSubsetSum(set, n, sum):
print("Found a subset with given sum")
else:
print("No subset with given sum")
OutputFound a subset with given sum
Complexity Analysis:
- Time Complexity: O(sum * n), where n is the size of the array.
- Auxiliary Space: O(sum), as the size of the 1-D array is sum+1.
Similar Reads
DSA Tutorial - Learn Data Structures and Algorithms DSA (Data Structures and Algorithms) is the study of organizing data efficiently using data structures like arrays, stacks, and trees, paired with step-by-step procedures (or algorithms) to solve problems effectively. Data structures manage how data is stored and accessed, while algorithms focus on
7 min read
Quick Sort QuickSort is a sorting algorithm based on the Divide and Conquer that picks an element as a pivot and partitions the given array around the picked pivot by placing the pivot in its correct position in the sorted array. It works on the principle of divide and conquer, breaking down the problem into s
12 min read
Merge Sort - Data Structure and Algorithms Tutorials Merge sort is a popular sorting algorithm known for its efficiency and stability. It follows the divide-and-conquer approach. It works by recursively dividing the input array into two halves, recursively sorting the two halves and finally merging them back together to obtain the sorted array. Merge
14 min read
Data Structures Tutorial Data structures are the fundamental building blocks of computer programming. They define how data is organized, stored, and manipulated within a program. Understanding data structures is very important for developing efficient and effective algorithms. What is Data Structure?A data structure is a st
2 min read
Bubble Sort Algorithm Bubble Sort is the simplest sorting algorithm that works by repeatedly swapping the adjacent elements if they are in the wrong order. This algorithm is not suitable for large data sets as its average and worst-case time complexity are quite high.We sort the array using multiple passes. After the fir
8 min read
Breadth First Search or BFS for a Graph Given a undirected graph represented by an adjacency list adj, where each adj[i] represents the list of vertices connected to vertex i. Perform a Breadth First Search (BFS) traversal starting from vertex 0, visiting vertices from left to right according to the adjacency list, and return a list conta
15+ min read
Binary Search Algorithm - Iterative and Recursive Implementation Binary Search Algorithm is a searching algorithm used in a sorted array by repeatedly dividing the search interval in half. The idea of binary search is to use the information that the array is sorted and reduce the time complexity to O(log N). Binary Search AlgorithmConditions to apply Binary Searc
15 min read
Insertion Sort Algorithm Insertion sort is a simple sorting algorithm that works by iteratively inserting each element of an unsorted list into its correct position in a sorted portion of the list. It is like sorting playing cards in your hands. You split the cards into two groups: the sorted cards and the unsorted cards. T
9 min read
Array Data Structure Guide In this article, we introduce array, implementation in different popular languages, its basic operations and commonly seen problems / interview questions. An array stores items (in case of C/C++ and Java Primitive Arrays) or their references (in case of Python, JS, Java Non-Primitive) at contiguous
4 min read
Sorting Algorithms A Sorting Algorithm is used to rearrange a given array or list of elements in an order. For example, a given array [10, 20, 5, 2] becomes [2, 5, 10, 20] after sorting in increasing order and becomes [20, 10, 5, 2] after sorting in decreasing order. There exist different sorting algorithms for differ
3 min read