Izvorni kod stranice Ro04-6790

{{Drugbox-lat
| verifiedrevid = 405764469
| IUPAC_name = 4-amino-''N''-[2,6-bis(metilamino)-4-pirimidinil]-benzensulfonamid
| image = Ro04-6790_structure.png
| width =
| image2 =
| width2 =

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| metabolism =  
| elimination_half-life =  
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number = 202466-68-0
| ATC_prefix = none
| ATC_suffix =  
| PubChem = 5312145
| IUPHAR_ligand = 274
| ChEMBL_Ref =
| ChEMBL =
| DrugBank_Ref =
| DrugBank =

<!--Chemical data-->
| C=12 | H=16 | N=6 | O=2 | S=1 
| molecular_weight = 308,359 g/mol
| smiles = Nc2ccc(cc2)S(=O)(=O)Nc1cc(NC)nc(NC)n1
| InChI  =
| InChIKey  =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
|  StdInChI = 1S/C12H16N6O2S/c1-14-10-7-11(17-12(15-2)16-10)18-21(19,20)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H3,14,15,16,17,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|  StdInChIKey = JELFWSXQTXRMAJ-UHFFFAOYSA-N
}}

'''Ro04-6790''' je [[lek]] koji se koristi u [[naučno istraživanje|naučnim istraživanjima]]. On deluje kao [[Potentnost (farmakologija)|potentan]] i [[selektivnost vezivanja|selektivan]] [[Receptor (biohemija)|receptorski]] [[Antagonist (farmakologija)|antagonist]] za [[5-HT6 receptor|5-HT<sub>6</sub>]] [[serotonin]]ski receptor, sa malim ili odsustvom [[afinitet (farmakologija)|afiniteta]] za druge receptore. Poput drugih lekova ove klase,<ref>Fone KC. An update on the role of the 5-hydroxytryptamine6 receptor in cognitive function. ''Neuropharmacology''. 2008 Nov;55(6):1015-22. {{DOI|10.1016/j.neuropharm.2008.06.061}} {{PMID|18655798}}</ref> Ro04-6790 ima [[nootropik|nootropne]] efekte na životinjama,<ref>King MV, Spicer CH, Sleight AJ, Marsden CA, Fone KC. Impact of regional 5-HT depletion on the cognitive enhancing effects of a typical 5-ht(6) receptor antagonist, Ro 04-6790, in the Novel Object Discrimination task. ''Psychopharmacology (Berlin)''. 2008 Oct 7. {{PMID|18839151}}</ref> i redukuje [[amnezija|amneziju]] proizvedenu lekovima koji ugrožavaju [[memorija|memoriju]], kao što je [[dizocilpin]]<ref>Pitsikas N, Zisopoulou S, Pappas I, Sakellaridis N. The selective 5-HT(6) receptor antagonist Ro 04-6790 attenuates psychotomimetic effects of the NMDA receptor antagonist MK-801. ''Behavioural Brain Research''. 2008 Apr 9;188(2):304-9. {{PMID|18164078}}</ref> i [[skopolamin]].<ref>Woolley ML, Marsden CA, Sleight AJ, Fone KC. Reversal of a cholinergic-induced deficit in a rodent model of recognition memory by the selective 5-HT6 receptor antagonist, Ro 04-6790. ''Psychopharmacology (Berlin)''. 2003 Dec;170(4):358-67. {{PMID|13680084}}</ref>

== Reference ==
{{Reflist}}

== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}

{{-}}
{{Serotonergici-lat}}

[[Kategorija:Nootropici]]
[[Kategorija:Pirimidini]]
[[Kategorija:5-HT6 antagonisti]]